Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium sulfide hydrate, tech., Thermo Scientific Chemicals
CAS: 27610-45-3 Molecular Formula: Na2S Molecular Weight (g/mol): 78.04 MDL Number: MFCD00149183 InChI Key: GRVFOGOEDUUMBP-UHFFFAOYSA-N PubChem CID: 45051681 SMILES: [Na+].[Na+].[S--]
| PubChem CID | 45051681 |
|---|---|
| CAS | 27610-45-3 |
| Molecular Weight (g/mol) | 78.04 |
| MDL Number | MFCD00149183 |
| SMILES | [Na+].[Na+].[S--] |
| InChI Key | GRVFOGOEDUUMBP-UHFFFAOYSA-N |
| Molecular Formula | Na2S |
Copper foil, 0.254mm (0.010in) thick, 99.9% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Iron(III) chloride hexahydrate, 97+%, ACS reagent
CAS: 10025-77-1 Molecular Formula: Cl3FeH12O6 Molecular Weight (g/mol): 270.29 MDL Number: MFCD00149712 InChI Key: NQXWGWZJXJUMQB-UHFFFAOYSA-K Synonym: Ferric chloride hexahydrate IUPAC Name: iron(3+) hexahydrate trichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 10025-77-1 |
|---|---|
| Molecular Weight (g/mol) | 270.29 |
| MDL Number | MFCD00149712 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[Fe+3] |
| Synonym | Ferric chloride hexahydrate |
| IUPAC Name | iron(3+) hexahydrate trichloride |
| InChI Key | NQXWGWZJXJUMQB-UHFFFAOYSA-K |
| Molecular Formula | Cl3FeH12O6 |
Thermo Scientific Chemicals FerroZine™ Iron Reagent, Hydrate, 95+%, Pure
CAS: 1266615-85-3 Molecular Formula: C20H13N4NaO6S2 Molecular Weight (g/mol): 492.46 MDL Number: MFCD00150794 InChI Key: ZGVNYCXXBQPDPQ-UHFFFAOYSA-M Synonym: ferrozine mono-sodium salt hydrate,ferrozine™ iron reagent,c20h13n4o6s2.na.h2o,pdt disulfonate monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p inverted exclamation marka-disulfonic acid monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p'-disulfonic acid monosodium salt hydrate PubChem CID: 129893581 IUPAC Name: sodium 4-[3-(pyridin-2-yl)-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzene-1-sulfonate SMILES: [Na+].OS(=O)(=O)C1=CC=C(C=C1)C1=C(N=C(N=N1)C1=CC=CC=N1)C1=CC=C(C=C1)S([O-])(=O)=O
| PubChem CID | 129893581 |
|---|---|
| CAS | 1266615-85-3 |
| Molecular Weight (g/mol) | 492.46 |
| MDL Number | MFCD00150794 |
| SMILES | [Na+].OS(=O)(=O)C1=CC=C(C=C1)C1=C(N=C(N=N1)C1=CC=CC=N1)C1=CC=C(C=C1)S([O-])(=O)=O |
| Synonym | ferrozine mono-sodium salt hydrate,ferrozine™ iron reagent,c20h13n4o6s2.na.h2o,pdt disulfonate monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p inverted exclamation marka-disulfonic acid monosodium salt hydrate,3-2-pyridyl-5,6-diphenyl-1,2,4-triazine-p,p'-disulfonic acid monosodium salt hydrate |
| IUPAC Name | sodium 4-[3-(pyridin-2-yl)-6-(4-sulfophenyl)-1,2,4-triazin-5-yl]benzene-1-sulfonate |
| InChI Key | ZGVNYCXXBQPDPQ-UHFFFAOYSA-M |
| Molecular Formula | C20H13N4NaO6S2 |
Sodium molybdate(VI) dihydrate, ACS reagent
CAS: 10102-40-6 Molecular Formula: H4MoNa2O6 Molecular Weight (g/mol): 241.96 MDL Number: MFCD00149170 InChI Key: FDEIWTXVNPKYDL-UHFFFAOYSA-N Synonym: sodium molybdate dihydrate,sodium molybdate vi dihydrate,disodium molybdate dihydrate,unii-8f2sxi1704,na2moo4.2h2o,disodium dihydrate molybdate,molybdic acid sodium salt dihydrate,molybdic acid, disodium salt, dihydrate,sodium molybdate 2 hydrate,dipotassium dihydrate molybdate PubChem CID: 16211258 ChEBI: CHEBI:75213 IUPAC Name: disodium dioxomolybdenumbis(olate) dihydrate SMILES: O.O.[Na+].[Na+].[O-][Mo]([O-])(=O)=O
| PubChem CID | 16211258 |
|---|---|
| CAS | 10102-40-6 |
| Molecular Weight (g/mol) | 241.96 |
| ChEBI | CHEBI:75213 |
| MDL Number | MFCD00149170 |
| SMILES | O.O.[Na+].[Na+].[O-][Mo]([O-])(=O)=O |
| Synonym | sodium molybdate dihydrate,sodium molybdate vi dihydrate,disodium molybdate dihydrate,unii-8f2sxi1704,na2moo4.2h2o,disodium dihydrate molybdate,molybdic acid sodium salt dihydrate,molybdic acid, disodium salt, dihydrate,sodium molybdate 2 hydrate,dipotassium dihydrate molybdate |
| IUPAC Name | disodium dioxomolybdenumbis(olate) dihydrate |
| InChI Key | FDEIWTXVNPKYDL-UHFFFAOYSA-N |
| Molecular Formula | H4MoNa2O6 |
Sodium methoxide, 0.5M solution in methanol, AcroSeal™
CAS: 124-41-4 Molecular Formula: CH3NaO Molecular Weight (g/mol): 54.02 MDL Number: MFCD00012179 InChI Key: WQDUMFSSJAZKTM-UHFFFAOYSA-N Synonym: sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 PubChem CID: 10942334 IUPAC Name: sodium;methanolate SMILES: C[O-].[Na+]
| PubChem CID | 10942334 |
|---|---|
| CAS | 124-41-4 |
| Molecular Weight (g/mol) | 54.02 |
| MDL Number | MFCD00012179 |
| SMILES | C[O-].[Na+] |
| Synonym | sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 |
| IUPAC Name | sodium;methanolate |
| InChI Key | WQDUMFSSJAZKTM-UHFFFAOYSA-N |
| Molecular Formula | CH3NaO |
Mercuric acetate, ACS reagent
CAS: 1600-27-7 Molecular Formula: C4H6HgO4 Molecular Weight (g/mol): 318.67 InChI Key: BRMYZIKAHFEUFJ-UHFFFAOYSA-L Synonym: mercury 2+ ion acetic acid PubChem CID: 15337 ChEBI: CHEBI:33211 IUPAC Name: mercury(2+);diacetate SMILES: CC(=O)[O-].CC(=O)[O-].[Hg+2]
| PubChem CID | 15337 |
|---|---|
| CAS | 1600-27-7 |
| Molecular Weight (g/mol) | 318.67 |
| ChEBI | CHEBI:33211 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Hg+2] |
| Synonym | mercury 2+ ion acetic acid |
| IUPAC Name | mercury(2+);diacetate |
| InChI Key | BRMYZIKAHFEUFJ-UHFFFAOYSA-L |
| Molecular Formula | C4H6HgO4 |
Sodium phosphate, tribasic dodecahydrate, 98%, for analysis
CAS: 10101-89-0 Molecular Formula: Na3O4P·12H2O Molecular Weight (g/mol): 380.13 MDL Number: MFCD00149198 InChI Key: ASTWEMOBIXQPPV-UHFFFAOYSA-K Synonym: trisodium phosphate dodecahydrate,sodium phosphate dodecahydrate,sodium phosphate tribasic dodecahydrate,phosphoric acid, trisodium salt, dodecahydrate,unii-b70850qphr,ccris 7322,sodium phosphate, tribasic, dodecahydrate,trisodium dodecahydrate phosphate,phosphoric acid, trisodium salt, dodeahydrate,trisodium phosphate tert dodecahydrate PubChem CID: 61473 IUPAC Name: trisodium;phosphate;dodecahydrate SMILES: O.O.O.O.O.O.O.O.O.O.O.O.[O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+]
| PubChem CID | 61473 |
|---|---|
| CAS | 10101-89-0 |
| Molecular Weight (g/mol) | 380.13 |
| MDL Number | MFCD00149198 |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.[O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+] |
| Synonym | trisodium phosphate dodecahydrate,sodium phosphate dodecahydrate,sodium phosphate tribasic dodecahydrate,phosphoric acid, trisodium salt, dodecahydrate,unii-b70850qphr,ccris 7322,sodium phosphate, tribasic, dodecahydrate,trisodium dodecahydrate phosphate,phosphoric acid, trisodium salt, dodeahydrate,trisodium phosphate tert dodecahydrate |
| IUPAC Name | trisodium;phosphate;dodecahydrate |
| InChI Key | ASTWEMOBIXQPPV-UHFFFAOYSA-K |
| Molecular Formula | Na3O4P·12H2O |
Sodium glucoheptonate
CAS: 31138-65-5 Molecular Formula: C7H13NaO8 Molecular Weight (g/mol): 248.163 MDL Number: MFCD00013425 InChI Key: FMYOMWCQJXWGEN-AXUKCSBQSA-M Synonym: sodium glucoheptonate,sodium 2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoate,d-sodium glucoheptonate,sodium-alpha-glucoheptonate,2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoic acid sodium salt PubChem CID: 49853507 IUPAC Name: sodium;(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate SMILES: C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+]
| PubChem CID | 49853507 |
|---|---|
| CAS | 31138-65-5 |
| Molecular Weight (g/mol) | 248.163 |
| MDL Number | MFCD00013425 |
| SMILES | C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+] |
| Synonym | sodium glucoheptonate,sodium 2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoate,d-sodium glucoheptonate,sodium-alpha-glucoheptonate,2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoic acid sodium salt |
| IUPAC Name | sodium;(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| InChI Key | FMYOMWCQJXWGEN-AXUKCSBQSA-M |
| Molecular Formula | C7H13NaO8 |
Chromium powder, -325 mesh, 99% (metals basis)
CAS: 7440-47-3 Molecular Formula: Cr Molecular Weight (g/mol): 52.00 MDL Number: MFCD00010944 InChI Key: VYZAMTAEIAYCRO-UHFFFAOYSA-N Synonym: chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 PubChem CID: 23976 ChEBI: CHEBI:28073 IUPAC Name: chromium SMILES: [Cr]
| PubChem CID | 23976 |
|---|---|
| CAS | 7440-47-3 |
| Molecular Weight (g/mol) | 52.00 |
| ChEBI | CHEBI:28073 |
| MDL Number | MFCD00010944 |
| SMILES | [Cr] |
| Synonym | chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 |
| IUPAC Name | chromium |
| InChI Key | VYZAMTAEIAYCRO-UHFFFAOYSA-N |
| Molecular Formula | Cr |
Mercury(I) nitrate dihydrate, ACS reagent, 9th edition
CAS: 7782-86-7 Molecular Formula: H4Hg2N2O8 Molecular Weight (g/mol): 561.22 InChI Key: LSABZDVKJBWCBE-UHFFFAOYSA-N IUPAC Name: dimercury(1+) dihydrate dinitrate SMILES: O.O.[Hg+].[Hg+].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| CAS | 7782-86-7 |
|---|---|
| Molecular Weight (g/mol) | 561.22 |
| SMILES | O.O.[Hg+].[Hg+].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| IUPAC Name | dimercury(1+) dihydrate dinitrate |
| InChI Key | LSABZDVKJBWCBE-UHFFFAOYSA-N |
| Molecular Formula | H4Hg2N2O8 |
Cerium(III) chloride, anhydrous, 99.5% (REO)
CAS: 7790-86-5 Molecular Formula: CeCl3 Molecular Weight (g/mol): 246.466 MDL Number: MFCD00010929 InChI Key: VYLVYHXQOHJDJL-UHFFFAOYSA-K Synonym: cerium iii chloride,cerous chloride,cerium iii chloride, anhydrous,cerium-144 chloride,cerium chloride generic,cerium-chloride,cerium chloride octahydrate,cerous iii-chloride PubChem CID: 24636 ChEBI: CHEBI:35458 IUPAC Name: cerium(3+);trichloride SMILES: [Cl-].[Cl-].[Cl-].[Ce+3]
| PubChem CID | 24636 |
|---|---|
| CAS | 7790-86-5 |
| Molecular Weight (g/mol) | 246.466 |
| ChEBI | CHEBI:35458 |
| MDL Number | MFCD00010929 |
| SMILES | [Cl-].[Cl-].[Cl-].[Ce+3] |
| Synonym | cerium iii chloride,cerous chloride,cerium iii chloride, anhydrous,cerium-144 chloride,cerium chloride generic,cerium-chloride,cerium chloride octahydrate,cerous iii-chloride |
| IUPAC Name | cerium(3+);trichloride |
| InChI Key | VYLVYHXQOHJDJL-UHFFFAOYSA-K |
| Molecular Formula | CeCl3 |
Osmium tetroxide, 99.9+%, (trace metal basis)
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Copper(II) nitrate, hemipentahydrate, 98+%, ACS reagent
CAS: 19004-19-4 Molecular Formula: 2·5 H2O Molecular Weight (g/mol): 232.6 MDL Number: MFCD02253001 Synonym: dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate
| CAS | 19004-19-4 |
|---|---|
| Molecular Weight (g/mol) | 232.6 |
| MDL Number | MFCD02253001 |
| Synonym | dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate |
| Molecular Formula | 2·5 H2O |
Copper(II) nitrate hemi(pentahydrate), ACS, 98.0-102.0%
CAS: 19004-19-4 Molecular Formula: CuN2O6·2.5H2O MDL Number: MFCD00149671 Synonym: dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate
| CAS | 19004-19-4 |
|---|---|
| MDL Number | MFCD00149671 |
| Synonym | dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate |
| Molecular Formula | CuN2O6·2.5H2O |